CAS 705941-70-4 is the registry number for 1-((4,5-Dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)methylamino)methanesulfonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 250mg.
Sodium [methyl-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)amino]methanesulfonate (CAS 705941-70-4) is a chemical compound with the molecular formula C12H14N3NaO4S and a molecular weight of 319.31 g/mol. IUPAC name: sodium [methyl-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)amino]methanesulfonate. InChIKey: OXYJVSFWKPLYIB-UHFFFAOYSA-M.
| Molecular formula | C12H14N3NaO4S |
|---|---|
| Molecular weight | 319.31 g/mol |
| IUPAC name | sodium [methyl-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)amino]methanesulfonate |
| InChIKey | OXYJVSFWKPLYIB-UHFFFAOYSA-M |
| SMILES | CC1=NN(C(=O)C1N(C)CS(=O)(=O)[O-])C2=CC=CC=C2.[Na+] |
Computed by PubChem (NCBI)