Products 70596-36-0

CAS 70596-36-0 appears in our catalog under these names: 2-Imino-4-oxo-1,3-thiazinane-6-carboxylic acid, 95%, 2-Imino-4-oxo-(1,3)thiazinane-6-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.

Structural formula: {0} (CAS {1})

2-amino-4-oxo-5,6-dihydro-1,3-thiazine-6-carboxylic acid (CAS 70596-36-0) is a chemical compound with the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. IUPAC name: 2-amino-4-oxo-5,6-dihydro-1,3-thiazine-6-carboxylic acid. InChIKey: VVWUMKXFIHHFOT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6N2O3S
Molecular weight174.18 g/mol
IUPAC name2-amino-4-oxo-5,6-dihydro-1,3-thiazine-6-carboxylic acid
InChIKeyVVWUMKXFIHHFOT-UHFFFAOYSA-N
SMILESC1C(SC(=NC1=O)N)C(=O)O

Computed by PubChem (NCBI)