CAS 706-89-8 is the registry number for 2-(2,2,3,3,3-Pentafluoropropoxymethyl)oxirane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane (CAS 706-89-8) is a chemical compound with the molecular formula C6H7F5O2 and a molecular weight of 206.11 g/mol. IUPAC name: 2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane. InChIKey: ABTNQISXTOWQTC-UHFFFAOYSA-N.
| Molecular formula | C6H7F5O2 |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 2-(2,2,3,3,3-pentafluoropropoxymethyl)oxirane |
| InChIKey | ABTNQISXTOWQTC-UHFFFAOYSA-N |
| SMILES | C1C(O1)COCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)