CAS 70603-31-5 appears in our catalog under these names: 1,2,4,5–Tetraethynylbenzene, 1,2,4,5-Tetraethynylbenzene 98%, 1,2,4,5-Tetraethynylbenzene, 98%, 98%, 1,2,4,5-Tetraethynylbenzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 2.5g, 10g.
1,2,4,5-tetraethynylbenzene (CAS 70603-31-5) is a chemical compound with the molecular formula C14H6 and a molecular weight of 174.20 g/mol. IUPAC name: 1,2,4,5-tetraethynylbenzene. InChIKey: QSGZOWMDALLUBC-UHFFFAOYSA-N.
| Molecular formula | C14H6 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1,2,4,5-tetraethynylbenzene |
| InChIKey | QSGZOWMDALLUBC-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1C#C)C#C)C#C |
Computed by PubChem (NCBI)