CAS 70607-85-1 appears in our catalog under these names: Gamma-Aminobutyric Acid-d6, >95% (HPLC), γ-Aminobutyric Acid-d6, >95% (HPLC), 4-Aminobutyric-2,2,3,3,4,4-d6 Acid, 99 atom % D, min 98% Chemical Purity, γ–Aminobutyric acid–d6, 4-Aminobutyric-2,2,3,3,4,4-D6. Offered by: TRC, CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 5mg, 0,1g, 0,05g, 50mg, 100mg, 10 mg.
4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid (CAS 70607-85-1) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 109.16 g/mol. IUPAC name: 4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid. InChIKey: BTCSSZJGUNDROE-NMFSSPJFSA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 109.16 g/mol |
| IUPAC name | 4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid |
| InChIKey | BTCSSZJGUNDROE-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N |
Computed by PubChem (NCBI)