CAS 70609-44-8 is the registry number for Bis(perfluorohexyl)phosphinic Acid Sodium Salt. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 25mg.
Sodium bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phosphinate (CAS 70609-44-8) is a chemical compound with the molecular formula C12F26NaO2P and a molecular weight of 724.05 g/mol. IUPAC name: sodium bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phosphinate. InChIKey: KJVRYSHRRDRBEW-UHFFFAOYSA-M.
| Molecular formula | C12F26NaO2P |
|---|---|
| Molecular weight | 724.05 g/mol |
| IUPAC name | sodium bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phosphinate |
| InChIKey | KJVRYSHRRDRBEW-UHFFFAOYSA-M |
| SMILES | C(C(C(C(F)(F)P(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-])(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)