Products 70619-09-9
CAS 70619-09-9 is the registry number for CYP3A4-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-fluorophenyl)methylideneamino]-3-pyridin-3-ylthiourea (CAS 70619-09-9) is a chemical compound with the molecular formula C13H11FN4S and a molecular weight of 274.32 g/mol. IUPAC name: 1-[(4-fluorophenyl)methylideneamino]-3-pyridin-3-ylthiourea. InChIKey: HQOQIUZLQCWHRZ-UHFFFAOYSA-N.
| Molecular formula | C13H11FN4S |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methylideneamino]-3-pyridin-3-ylthiourea |
| InChIKey | HQOQIUZLQCWHRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC(=S)NN=CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)