CAS 7063-21-0 appears in our catalog under these names: Sodium 3-oxo-3-phenylpropanoate, 95%, Sodium 3–oxo–3–phenylpropanoate, Sodium 3-oxo-3-phenylpropanoate, Sodium 3-oxo-3-phenylpropanoate, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
Sodium 3-oxo-3-phenylpropanoate (CAS 7063-21-0) is a chemical compound with the molecular formula C9H7NaO3 and a molecular weight of 186.14 g/mol. IUPAC name: sodium 3-oxo-3-phenylpropanoate. InChIKey: ALIIURBGZRQXFQ-UHFFFAOYSA-M.
| Molecular formula | C9H7NaO3 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | sodium 3-oxo-3-phenylpropanoate |
| InChIKey | ALIIURBGZRQXFQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)