CAS 70672-05-8 appears in our catalog under these names: 3'-O-Methylfluorescein, 3''-O-Methylfluorescein, 3'-Hydroxy-6'-methoxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one 98%, 3'-Hydroxy-6'-methoxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 98%, 98%. Offered by: TRC, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 50mg, 10mg, 5mg, 25mg, 1g.
3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 70672-05-8) is a chemical compound with the molecular formula C21H14O5 and a molecular weight of 346.3 g/mol. IUPAC name: 3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: KDXNYSZNOWTPLE-UHFFFAOYSA-N.
| Molecular formula | C21H14O5 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | KDXNYSZNOWTPLE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)O)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)