CAS 707-35-7 appears in our catalog under these names: 1,3,5-Trimethyl Adamantane, 1,3,5-Trimethyladamantane, 1,3,5–Trimethyladamantane, 1,3,5-Trimethyladamantane 95%, 1,3,5-Trimethyladamantane, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 100mg, 0,1g, 0,05g, 0,25g, 0,5g.
1,3,5-trimethyladamantane (CAS 707-35-7) is a chemical compound with the molecular formula C13H22 and a molecular weight of 178.31 g/mol. IUPAC name: 1,3,5-trimethyladamantane. InChIKey: WCACLGXPFTYVEL-UHFFFAOYSA-N.
| Molecular formula | C13H22 |
|---|---|
| Molecular weight | 178.31 g/mol |
| IUPAC name | 1,3,5-trimethyladamantane |
| InChIKey | WCACLGXPFTYVEL-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)C)C |
Computed by PubChem (NCBI)