CAS 707-36-8 appears in our catalog under these names: 1-Chloro-3,5-Dimethyladamantane, 1–Chloro–3,5–dimethyladamantane, 1-Chloro-3,5-dimethyladamantane, >98.0%(GC), 1-Chloro-3,5-dimethyl adamantane, 1-Chloro-3,5-dimethyladamantane 98%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 1g, 250mg, 50mg, 25mg, 25g, 5g, 50g.
1-chloro-3,5-dimethyladamantane (CAS 707-36-8) is a chemical compound with the molecular formula C12H19Cl and a molecular weight of 198.73 g/mol. IUPAC name: 1-chloro-3,5-dimethyladamantane. InChIKey: PXDRFQZLDWZHPX-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl |
|---|---|
| Molecular weight | 198.73 g/mol |
| IUPAC name | 1-chloro-3,5-dimethyladamantane |
| InChIKey | PXDRFQZLDWZHPX-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)Cl)C |
Computed by PubChem (NCBI)