CAS 707-55-1 is the registry number for 1,1,2,3,4,5,6-Heptachlorocyclohexane. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
1,1,2,3,4,5,6-heptachlorocyclohexane (CAS 707-55-1) is a chemical compound with the molecular formula C6H5Cl7 and a molecular weight of 325.3 g/mol. IUPAC name: 1,1,2,3,4,5,6-heptachlorocyclohexane. InChIKey: DWMMFAQCEHVJPE-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl7 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 1,1,2,3,4,5,6-heptachlorocyclohexane |
| InChIKey | DWMMFAQCEHVJPE-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1Cl)Cl)(Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)