Products 70711-53-4
CAS 70711-53-4 appears in our catalog under these names: Phenindione-d5, Phenindione D5, Phenindione-d5, 99.50%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 25mg, 2mg, 1 mg, 5 mg, 10 mg.
2-(2,3,4,5,6-pentadeuteriophenyl)indene-1,3-dione (CAS 70711-53-4) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 227.27 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenyl)indene-1,3-dione. InChIKey: NFBAXHOPROOJAW-FSTBWYLISA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 227.27 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenyl)indene-1,3-dione |
| InChIKey | NFBAXHOPROOJAW-FSTBWYLISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2C(=O)C3=CC=CC=C3C2=O)[2H])[2H] |
Computed by PubChem (NCBI)