CAS 70716-46-0 is the registry number for Epoprostenol 15-R-epimer Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
CAS 70716-46-0 identifies a chemical compound with the molecular formula C21H34NaO5 and a molecular weight of 389.5 g/mol. InChIKey: VMEONVJNZVYKLB-XMMBJHEHSA-N.
| Molecular formula | C21H34NaO5 |
|---|---|
| Molecular weight | 389.5 g/mol |
| InChIKey | VMEONVJNZVYKLB-XMMBJHEHSA-N |
| SMILES | CCCCCC[C@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C\CCCC(=O)O)/O2)O)O.[Na] |
Computed by PubChem (NCBI)