Products 70717-18-9

CAS 70717-18-9 is the registry number for 2-(N-Methylacetamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[acetyl(methyl)amino]propanoic acid (CAS 70717-18-9) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: 2-[acetyl(methyl)amino]propanoic acid. InChIKey: CSNMMNNSBJWRQB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO3
Molecular weight145.16 g/mol
IUPAC name2-[acetyl(methyl)amino]propanoic acid
InChIKeyCSNMMNNSBJWRQB-UHFFFAOYSA-N
SMILESCC(C(=O)O)N(C)C(=O)C

Computed by PubChem (NCBI)