Products 70729-65-6
CAS 70729-65-6 is the registry number for Disperse red 311. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[3-acetamido-4-[(2,4-dinitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate (CAS 70729-65-6) is a chemical compound with the molecular formula C22H24N6O9 and a molecular weight of 516.5 g/mol. IUPAC name: methyl 3-[3-acetamido-4-[(2,4-dinitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate. InChIKey: FIIPIQBWGBRMTN-UHFFFAOYSA-N.
| Molecular formula | C22H24N6O9 |
|---|---|
| Molecular weight | 516.5 g/mol |
| IUPAC name | methyl 3-[3-acetamido-4-[(2,4-dinitrophenyl)diazenyl]-N-(3-methoxy-3-oxopropyl)anilino]propanoate |
| InChIKey | FIIPIQBWGBRMTN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)N(CCC(=O)OC)CCC(=O)OC)N=NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)