CAS 7078-98-0 appears in our catalog under these names: 4–Benzylidene–2,6–di–tert–butylcyclohexa–2,5–dien–1–one, 4-Benzylidene-2,6-di-tert-butylcyclohexa-2,5-dien-1-one, 2,6-BIS(1,1-DIMETHYLETHYL)-4-(PHENYLMETHYLENE)-2,5-CYCLOHEXADIEN-1-ONE, 95%, 95%, 4-Benzylidene-2,6-di-tert-butylcyclohexa-2,5-dien-1-one, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 50g, 10g, 100g, 250mg, 1g, 75g.
4-benzylidene-2,6-ditert-butylcyclohexa-2,5-dien-1-one (CAS 7078-98-0) is a chemical compound with the molecular formula C21H26O and a molecular weight of 294.4 g/mol. IUPAC name: 4-benzylidene-2,6-ditert-butylcyclohexa-2,5-dien-1-one. InChIKey: HCUWXYBKPSKTAB-UHFFFAOYSA-N.
| Molecular formula | C21H26O |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 4-benzylidene-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| InChIKey | HCUWXYBKPSKTAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC2=CC=CC=C2)C=C(C1=O)C(C)(C)C |
Computed by PubChem (NCBI)