CAS 70795-33-4 appears in our catalog under these names: Cortisol Impurity 5 Sodium Salt, 21-(3-Carboxy-1-oxopropoxy)-17-hydroxy-pregn-4-ene-3,20-dione Monosodium Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
CAS 70795-33-4 identifies a chemical compound with the molecular formula C25H34NaO7 and a molecular weight of 469.5 g/mol. InChIKey: RBIFCNQIHNLNNX-OWIXMUDHSA-N.
| Molecular formula | C25H34NaO7 |
|---|---|
| Molecular weight | 469.5 g/mol |
| InChIKey | RBIFCNQIHNLNNX-OWIXMUDHSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C(=O)COC(=O)CCC(=O)O)O)C.[Na] |
Computed by PubChem (NCBI)