CAS 70796-17-7 appears in our catalog under these names: L–Citrulline DL–malate, L-Citrulline DL-malate - 1:1, H-Cit-OH H-DL-Malate-OH 96+%, H-Cit-OH H-DL-Malate-OH 96%, L-Citrulline DL-malate (1:1), 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 10g, 5g, 50g, 500g, 250mg, 1g.
(2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid (CAS 70796-17-7) is a chemical compound with the molecular formula C10H19N3O8 and a molecular weight of 309.27 g/mol. IUPAC name: (2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid. InChIKey: DROVUXYZTXCEBX-WCCKRBBISA-N.
| Molecular formula | C10H19N3O8 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | (2S)-2-amino-5-(carbamoylamino)pentanoic acid;2-hydroxybutanedioic acid |
| InChIKey | DROVUXYZTXCEBX-WCCKRBBISA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)N.C(C(C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)