CAS 708275-58-5 appears in our catalog under these names: JNJ 10397049, JNJ 10397049, JNJ-10397049, 99+%, JNJ-10397049, JNJ-10397049, 99.91%, 99.91%. Offered by: GLPBio, TRC, AmBeed, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 2mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 1mg.
1-(2,4-dibromophenyl)-3-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]urea (CAS 708275-58-5) is a chemical compound with the molecular formula C19H20Br2N2O3 and a molecular weight of 484.2 g/mol. IUPAC name: 1-(2,4-dibromophenyl)-3-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]urea. InChIKey: RBKIJGLHFFQHBE-IRXDYDNUSA-N.
| Molecular formula | C19H20Br2N2O3 |
|---|---|
| Molecular weight | 484.2 g/mol |
| IUPAC name | 1-(2,4-dibromophenyl)-3-[(4S,5S)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]urea |
| InChIKey | RBKIJGLHFFQHBE-IRXDYDNUSA-N |
| SMILES | CC1(OC[C@@H]([C@@H](O1)C2=CC=CC=C2)NC(=O)NC3=C(C=C(C=C3)Br)Br)C |
Computed by PubChem (NCBI)