CAS 708293-02-1 appears in our catalog under these names: Tricyclo[3.3.1.13,7]decane-1-acetamide, n-(4-bromophenyl)-, 95%, Tricyclo[3.3.1.13,7]decane-1-acetamide, N-(4-bromophenyl)-, 97%, 97%, 2-(ADAMANTAN-1-YL)-N-(4-BROMOPHENYL)ACETAMIDE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg.
2-(1-adamantyl)-N-(4-bromophenyl)acetamide (CAS 708293-02-1) is a chemical compound with the molecular formula C18H22BrNO and a molecular weight of 348.3 g/mol. IUPAC name: 2-(1-adamantyl)-N-(4-bromophenyl)acetamide. InChIKey: WSFWHWPXYGDTJQ-UHFFFAOYSA-N.
| Molecular formula | C18H22BrNO |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 2-(1-adamantyl)-N-(4-bromophenyl)acetamide |
| InChIKey | WSFWHWPXYGDTJQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)NC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)