CAS 70838-72-1 is the registry number for Ethyl Mandelate-d5. Offered by: TRC. Available pack sizes: 25mg.
Ethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate (CAS 70838-72-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 185.23 g/mol. IUPAC name: ethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate. InChIKey: SAXHIDRUJXPDOD-DKFMXDSJSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 185.23 g/mol |
| IUPAC name | ethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate |
| InChIKey | SAXHIDRUJXPDOD-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C(=O)OCC)O)[2H])[2H] |
Computed by PubChem (NCBI)