Products 70838-72-1

CAS 70838-72-1 is the registry number for Ethyl Mandelate-d5. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate (CAS 70838-72-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 185.23 g/mol. IUPAC name: ethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate. InChIKey: SAXHIDRUJXPDOD-DKFMXDSJSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight185.23 g/mol
IUPAC nameethyl 2-hydroxy-2-(2,3,4,5,6-pentadeuteriophenyl)acetate
InChIKeySAXHIDRUJXPDOD-DKFMXDSJSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])C(C(=O)OCC)O)[2H])[2H]

Computed by PubChem (NCBI)

Synonyms: Ethyl Mandelate-d5