Products 70862-65-6

CAS 70862-65-6 appears in our catalog under these names: 1,3-Didecyl-2-methylimidazolium chloride, 96%, 1,3-DIDECYL-2-METHYLIMIDAZOLIUM CHLORID&, 1,3-Didecyl-2-methylimidazolium chloride, ≥96%, ≥96%, 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride, ≥96%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1,3-didecyl-2-methylimidazol-1-ium chloride (CAS 70862-65-6) is a chemical compound with the molecular formula C24H47ClN2 and a molecular weight of 399.1 g/mol. IUPAC name: 1,3-didecyl-2-methylimidazol-1-ium chloride. InChIKey: GJYWPRKIEORZLX-UHFFFAOYSA-M.

Identity
Molecular formulaC24H47ClN2
Molecular weight399.1 g/mol
IUPAC name1,3-didecyl-2-methylimidazol-1-ium chloride
InChIKeyGJYWPRKIEORZLX-UHFFFAOYSA-M
SMILESCCCCCCCCCCN1C=C[N+](=C1C)CCCCCCCCCC.[Cl-]

Computed by PubChem (NCBI)