Products 70865-20-2
CAS 70865-20-2 is the registry number for Acid yellow 199. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[4-[(4-hydroxy-2-methylphenyl)diazenyl]anilino]-3-nitrobenzenesulfonate (CAS 70865-20-2) is a chemical compound with the molecular formula C19H15N4NaO6S and a molecular weight of 450.4 g/mol. IUPAC name: sodium 4-[4-[(4-hydroxy-2-methylphenyl)diazenyl]anilino]-3-nitrobenzenesulfonate. InChIKey: JXRBVOFBCVPZOV-UHFFFAOYSA-M.
| Molecular formula | C19H15N4NaO6S |
|---|---|
| Molecular weight | 450.4 g/mol |
| IUPAC name | sodium 4-[4-[(4-hydroxy-2-methylphenyl)diazenyl]anilino]-3-nitrobenzenesulfonate |
| InChIKey | JXRBVOFBCVPZOV-UHFFFAOYSA-M |
| SMILES | CC1=C(C=CC(=C1)O)N=NC2=CC=C(C=C2)NC3=C(C=C(C=C3)S(=O)(=O)[O-])[N+](=O)[O-].[Na+] |
Computed by PubChem (NCBI)