CAS 708999-15-9 is the registry number for DA8. Offered by: TRC. Available pack sizes: 100mg.
2-(1-adamantyl)-N-(3-chloro-4-fluorophenyl)acetamide (CAS 708999-15-9) is a chemical compound with the molecular formula C18H21ClFNO and a molecular weight of 321.8 g/mol. IUPAC name: 2-(1-adamantyl)-N-(3-chloro-4-fluorophenyl)acetamide. InChIKey: AVODMMZOBRTDDO-UHFFFAOYSA-N.
| Molecular formula | C18H21ClFNO |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 2-(1-adamantyl)-N-(3-chloro-4-fluorophenyl)acetamide |
| InChIKey | AVODMMZOBRTDDO-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)NC4=CC(=C(C=C4)F)Cl |
Computed by PubChem (NCBI)