Products 709-62-6

CAS 709-62-6 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-1H-1,2,4-triazole, >95% (HPLC), 3,5–Bis(trifluoromethyl)–4H–1,2,4–triazole, 3,5-Bis(trifluoromethyl)-1H-1,2,4-triazole, 3,5-Bis(trifluoromethyl)-1H-1,2,4-triazole, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

3,5-bis(trifluoromethyl)-1H-1,2,4-triazole (CAS 709-62-6) is a chemical compound with the molecular formula C4HF6N3 and a molecular weight of 205.06 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)-1H-1,2,4-triazole. InChIKey: NIGUTEXYIRYTPY-UHFFFAOYSA-N.

Identity
Molecular formulaC4HF6N3
Molecular weight205.06 g/mol
IUPAC name3,5-bis(trifluoromethyl)-1H-1,2,4-triazole
InChIKeyNIGUTEXYIRYTPY-UHFFFAOYSA-N
SMILESC1(=NC(=NN1)C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)