CAS 70940-99-7 is the registry number for 4-Oxo-4H-thiochromene-3-carbaldehyde, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-oxothiochromene-3-carbaldehyde (CAS 70940-99-7) is a chemical compound with the molecular formula C10H6O2S and a molecular weight of 190.22 g/mol. IUPAC name: 4-oxothiochromene-3-carbaldehyde. InChIKey: UBHXHANDDCHPTQ-UHFFFAOYSA-N.
| Molecular formula | C10H6O2S |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | 4-oxothiochromene-3-carbaldehyde |
| InChIKey | UBHXHANDDCHPTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CS2)C=O |
Computed by PubChem (NCBI)