CAS 70942-82-4 is the registry number for 9,10-Dibromoanthracene-2-sulfonic Acid. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
9,10-dibromoanthracene-2-sulfonic acid (CAS 70942-82-4) is a chemical compound with the molecular formula C14H8Br2O3S and a molecular weight of 416.1 g/mol. IUPAC name: 9,10-dibromoanthracene-2-sulfonic acid. InChIKey: GKVAYKWWVFDEOJ-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2O3S |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | 9,10-dibromoanthracene-2-sulfonic acid |
| InChIKey | GKVAYKWWVFDEOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC(=CC3=C2Br)S(=O)(=O)O)Br |
Computed by PubChem (NCBI)