CAS 709608-92-4 appears in our catalog under these names: 1,4-Butane-1,1,2,2,3,3,4,4-d8-diamine, >95% (HPLC), 1,4-Butane-d8-diamine, 98 atom % D, min 98% Chemical Purity, D8-1,4-Diaminobutane. Offered by: TRC, CDN, HPC Standards. Available pack sizes: 100mg, 10mg, 25mg, 0,25g, 0,1g, 1x10mg.
1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine (CAS 709608-92-4) is a chemical compound with the molecular formula C4H12N2 and a molecular weight of 96.20 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine. InChIKey: KIDHWZJUCRJVML-SVYQBANQSA-N.
| Molecular formula | C4H12N2 |
|---|---|
| Molecular weight | 96.20 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octadeuteriobutane-1,4-diamine |
| InChIKey | KIDHWZJUCRJVML-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])N)C([2H])([2H])N |
Computed by PubChem (NCBI)