CAS 709649-73-0 is the registry number for N-Methyl-N-[(1-methyl-1H-indol-5-yl)methyl]amine, 90% . Offered by: Thermo Scientific. Available pack sizes: 1g.
N-methyl-1-(1-methylindol-5-yl)methanamine (CAS 709649-73-0) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: N-methyl-1-(1-methylindol-5-yl)methanamine. InChIKey: SPRYNBKTIVXUOJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | N-methyl-1-(1-methylindol-5-yl)methanamine |
| InChIKey | SPRYNBKTIVXUOJ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC2=C(C=C1)N(C=C2)C |
Computed by PubChem (NCBI)