CAS 71025-82-6 is the registry number for (S)-2-Amino-1-phenylethanol hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(1S)-2-amino-1-phenylethanol;hydrochloride (CAS 71025-82-6) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. IUPAC name: (1S)-2-amino-1-phenylethanol;hydrochloride. InChIKey: GMYDEDCMIQAOCT-DDWIOCJRSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 173.64 g/mol |
| IUPAC name | (1S)-2-amino-1-phenylethanol;hydrochloride |
| InChIKey | GMYDEDCMIQAOCT-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CN)O.Cl |
Computed by PubChem (NCBI)