CAS 710291-06-8 is the registry number for N-(2-Bromophenyl)-2,6-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2-bromophenyl)-2,6-difluorobenzamide (CAS 710291-06-8) is a chemical compound with the molecular formula C13H8BrF2NO and a molecular weight of 312.11 g/mol. IUPAC name: N-(2-bromophenyl)-2,6-difluorobenzamide. InChIKey: UQJVZAKVKZRKMF-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF2NO |
|---|---|
| Molecular weight | 312.11 g/mol |
| IUPAC name | N-(2-bromophenyl)-2,6-difluorobenzamide |
| InChIKey | UQJVZAKVKZRKMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=C(C=CC=C2F)F)Br |
Computed by PubChem (NCBI)