CAS 710298-40-1 is the registry number for N1-(3-Bromobenzyl)-N4,N4-dimethylbenzene-1,4-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-N-[(3-bromophenyl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine (CAS 710298-40-1) is a chemical compound with the molecular formula C15H17BrN2 and a molecular weight of 305.21 g/mol. IUPAC name: 1-N-[(3-bromophenyl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine. InChIKey: FMMUOEDYDHBYDL-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2 |
|---|---|
| Molecular weight | 305.21 g/mol |
| IUPAC name | 1-N-[(3-bromophenyl)methyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| InChIKey | FMMUOEDYDHBYDL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NCC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)