CAS 71031-15-7 is the registry number for S(-)-Cathinone hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 10mg.
Cathinone is the S stereoisomer of 2-aminopropiophenone. It has a role as a central nervous system stimulant and a psychotropic drug. It is a 2-aminopropiophenone and a monoamine alkaloid.
Source: ChEBI
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | (2S)-2-amino-1-phenylpropan-1-one |
| InChIKey | PUAQLLVFLMYYJJ-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)C1=CC=CC=C1)N |
Computed by PubChem (NCBI)