CAS 710315-25-6 is the registry number for 4-((6-Methyl-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl)-3-nitrobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrobenzoic acid (CAS 710315-25-6) is a chemical compound with the molecular formula C12H9N3O5S and a molecular weight of 307.28 g/mol. IUPAC name: 4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrobenzoic acid. InChIKey: LJFCOOQGQCUESF-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O5S |
|---|---|
| Molecular weight | 307.28 g/mol |
| IUPAC name | 4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrobenzoic acid |
| InChIKey | LJFCOOQGQCUESF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC(=N1)SC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)