CAS 71041-12-8 appears in our catalog under these names: 3,7-Dibromo-10-phenyl-10H-phenoxazine, 3,7-Dibromo-10-phenyl-10H-phenoxazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3,7-dibromo-10-phenylphenoxazine (CAS 71041-12-8) is a chemical compound with the molecular formula C18H11Br2NO and a molecular weight of 417.1 g/mol. IUPAC name: 3,7-dibromo-10-phenylphenoxazine. InChIKey: DGMARKIFPUNHBC-UHFFFAOYSA-N.
| Molecular formula | C18H11Br2NO |
|---|---|
| Molecular weight | 417.1 g/mol |
| IUPAC name | 3,7-dibromo-10-phenylphenoxazine |
| InChIKey | DGMARKIFPUNHBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)Br)OC4=C2C=CC(=C4)Br |
Computed by PubChem (NCBI)