CAS 71048-65-2 appears in our catalog under these names: (S)-2-((4-Methoxyphenoxy)methyl)oxirane, 98%, (S)-O-(4-Methoxyphenyl)glycidol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1g.
(2S)-2-[(4-methoxyphenoxy)methyl]oxirane (CAS 71048-65-2) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2S)-2-[(4-methoxyphenoxy)methyl]oxirane. InChIKey: AVWGFHZLPMLKBL-SNVBAGLBSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2S)-2-[(4-methoxyphenoxy)methyl]oxirane |
| InChIKey | AVWGFHZLPMLKBL-SNVBAGLBSA-N |
| SMILES | COC1=CC=C(C=C1)OC[C@@H]2CO2 |
Computed by PubChem (NCBI)