Products 71077-30-0

CAS 71077-30-0 is the registry number for Butyl 3,7-dimethyloct-6-en-1-yl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

8-butoxy-2,6-dimethyloct-2-ene (CAS 71077-30-0) is a chemical compound with the molecular formula C14H28O and a molecular weight of 212.37 g/mol. IUPAC name: 8-butoxy-2,6-dimethyloct-2-ene. InChIKey: ZEBHRRNMSFKVIM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H28O
Molecular weight212.37 g/mol
IUPAC name8-butoxy-2,6-dimethyloct-2-ene
InChIKeyZEBHRRNMSFKVIM-UHFFFAOYSA-N
SMILESCCCCOCCC(C)CCC=C(C)C

Computed by PubChem (NCBI)