CAS 710945-67-8 is the registry number for N-(1H-Indol-5-yl)benzo[c][1,2,5]oxadiazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1H-indol-5-yl)-2,1,3-benzoxadiazole-5-carboxamide (CAS 710945-67-8) is a chemical compound with the molecular formula C15H10N4O2 and a molecular weight of 278.26 g/mol. IUPAC name: N-(1H-indol-5-yl)-2,1,3-benzoxadiazole-5-carboxamide. InChIKey: INQJLNGRNLTVPW-UHFFFAOYSA-N.
| Molecular formula | C15H10N4O2 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | N-(1H-indol-5-yl)-2,1,3-benzoxadiazole-5-carboxamide |
| InChIKey | INQJLNGRNLTVPW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C=C1C(=O)NC3=CC4=C(C=C3)NC=C4 |
Computed by PubChem (NCBI)