CAS 71098-88-9 appears in our catalog under these names: N-(PHENYLSELENO)PHTHALIMIDE, TECH., 2-(Phenylselanyl)isoindoline-1,3-dione. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 1G, 5G, 500mg.
2-phenylselanylisoindole-1,3-dione (CAS 71098-88-9) is a chemical compound with the molecular formula C14H9NO2Se and a molecular weight of 302.20 g/mol. IUPAC name: 2-phenylselanylisoindole-1,3-dione. InChIKey: TYZFQSLJTWPSDS-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2Se |
|---|---|
| Molecular weight | 302.20 g/mol |
| IUPAC name | 2-phenylselanylisoindole-1,3-dione |
| InChIKey | TYZFQSLJTWPSDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)