CAS 711-46-6 is the registry number for 2-(4-Fluoro-7-methyl-1H-indol-3-yl)ethanamine. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-(4-fluoro-7-methyl-1H-indol-3-yl)ethanamine (CAS 711-46-6) is a chemical compound with the molecular formula C11H13FN2 and a molecular weight of 192.23 g/mol. IUPAC name: 2-(4-fluoro-7-methyl-1H-indol-3-yl)ethanamine. InChIKey: UFQFJBGUDFFQCK-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2 |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | 2-(4-fluoro-7-methyl-1H-indol-3-yl)ethanamine |
| InChIKey | UFQFJBGUDFFQCK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)F)C(=CN2)CCN |
Computed by PubChem (NCBI)