CAS 71125-39-8 appears in our catalog under these names: Meloxicam Sodium, Meloxicam (sodium). Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 500mg, 25mg, 50mg, 100mg, Get quote.
Sodium 2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]-1,1-dioxo-1lambda6,2-benzothiazin-4-olate (CAS 71125-39-8) is a chemical compound with the molecular formula C14H12N3NaO4S2 and a molecular weight of 373.4 g/mol. IUPAC name: sodium 2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]-1,1-dioxo-1lambda6,2-benzothiazin-4-olate. InChIKey: PTCPMRKGGUPNDO-UHFFFAOYSA-M.
| Molecular formula | C14H12N3NaO4S2 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | sodium 2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]-1,1-dioxo-1lambda6,2-benzothiazin-4-olate |
| InChIKey | PTCPMRKGGUPNDO-UHFFFAOYSA-M |
| SMILES | CC1=CN=C(S1)NC(=O)C2=C(C3=CC=CC=C3S(=O)(=O)N2C)[O-].[Na+] |
Computed by PubChem (NCBI)