CAS 71140-70-0 appears in our catalog under these names: Tafluprost Impurity 9, 5-(Diphenylphosphinyl)pentanoic Acid, 5-(Diphenylphosphoryl)pentanoic acid, 95+%, 5-(Diphenylphosphinyl)pentanoic Acid, >95% (HPLC), Diphenylphosphine Acid. Offered by: Chemat Brand, AmBeed, TRC, GLPBio, Biosynth. Available pack sizes: on request, 5g, 10mg, 250mg, 50mg, 100mg, 5mg, 25mg.
Sodium 5-diphenylphosphorylpentanoate (CAS 71140-70-0) is a chemical compound with the molecular formula C17H18NaO3P and a molecular weight of 324.29 g/mol. IUPAC name: sodium 5-diphenylphosphorylpentanoate. InChIKey: FPELTQBQNWIJFD-UHFFFAOYSA-M.
| Molecular formula | C17H18NaO3P |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | sodium 5-diphenylphosphorylpentanoate |
| InChIKey | FPELTQBQNWIJFD-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)P(=O)(CCCCC(=O)[O-])C2=CC=CC=C2.[Na+] |
Computed by PubChem (NCBI)