Products 71184-74-2

CAS 71184-74-2 is the registry number for (R)-2-(2-(2-aminoacetamido)acetamido)-4-methylpentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-methylpentanoic acid (CAS 71184-74-2) is a chemical compound with the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. IUPAC name: 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-methylpentanoic acid. InChIKey: XPJBQTCXPJNIFE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19N3O4
Molecular weight245.28 g/mol
IUPAC name2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-methylpentanoic acid
InChIKeyXPJBQTCXPJNIFE-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)NC(=O)CNC(=O)CN

Computed by PubChem (NCBI)