Products 71193-32-3

CAS 71193-32-3 is the registry number for 2-Chloro-1,2-di-p-tolyl-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2-chloro-1,2-bis(4-methylphenyl)ethanone (CAS 71193-32-3) is a chemical compound with the molecular formula C16H15ClO and a molecular weight of 258.74 g/mol. IUPAC name: 2-chloro-1,2-bis(4-methylphenyl)ethanone. InChIKey: NNLSZLIKQWMSNT-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15ClO
Molecular weight258.74 g/mol
IUPAC name2-chloro-1,2-bis(4-methylphenyl)ethanone
InChIKeyNNLSZLIKQWMSNT-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)C)Cl

Computed by PubChem (NCBI)