Products 71195-64-7
CAS 71195-64-7 appears in our catalog under these names: Diisobutyl glutarate, 95%, 95%, DIISOBUTYL GLUTARATE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Bis(2-methylpropyl) pentanedioate (CAS 71195-64-7) is a chemical compound with the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. IUPAC name: bis(2-methylpropyl) pentanedioate. InChIKey: UFWRCRCDRAUAAO-UHFFFAOYSA-N.
| Molecular formula | C13H24O4 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | bis(2-methylpropyl) pentanedioate |
| InChIKey | UFWRCRCDRAUAAO-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)CCCC(=O)OCC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Diisobutyl glutarate, Pentanedioic acid, bis(2-methylpropyl) ester, Glutaric acid, diisobutyl ester, Pentanedioic acid, 1,5-bis(2-methylpropyl) ester, Pentanedioic acid bis(2-methylpropyl) ester, diisobutyl glutarate, DIISOBUTYL GLUTARATE [INCI], bis(2-methylpropyl) pentanedioate, Pentanedioic acid,1,5-bis(2-methylpropyl) ester, glutaric acid diisobutyl ester, Diisobutyl AGS