CAS 7120-02-7 appears in our catalog under these names: N-[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]guanidine, 95%, 1-(4-(4-Chlorophenyl)thiazol-2-yl)guanidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine (CAS 7120-02-7) is a chemical compound with the molecular formula C10H9ClN4S and a molecular weight of 252.72 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine. InChIKey: YWOBYKMDDDYFTG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]guanidine |
| InChIKey | YWOBYKMDDDYFTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)N=C(N)N)Cl |
Computed by PubChem (NCBI)