CAS 7123-77-5 appears in our catalog under these names: 4-(1-Adamantanyl)aniline hydrochloride, 96%, 4-(1-Adamantanyl)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-(1-adamantyl)aniline;hydrochloride (CAS 7123-77-5) is a chemical compound with the molecular formula C16H22ClN and a molecular weight of 263.80 g/mol. IUPAC name: 4-(1-adamantyl)aniline;hydrochloride. InChIKey: NRAKTESVTUZFBK-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN |
|---|---|
| Molecular weight | 263.80 g/mol |
| IUPAC name | 4-(1-adamantyl)aniline;hydrochloride |
| InChIKey | NRAKTESVTUZFBK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)N.Cl |
Computed by PubChem (NCBI)