CAS 71283-80-2 appears in our catalog under these names: Fenoxaprop-p-ethyl, 95%, Fenoxaprop-P-ethyl, Fenoxaprop-P-ethyl 100 µg/mL in Acetonitrile, Fenoxaprop–P–ethyl, Fenoxaprop-P-ethyl, >95.0%(HPLC). Offered by: Combi-blocks, Dr. Ehrenstorfer, TargetMol, GLPBio, TCI. Available pack sizes: 5g, 1g, 250mg, 1ml, 500mg, 10mM (in 1ml dmso), 25g, 5 g.
Ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate (CAS 71283-80-2) is a chemical compound with the molecular formula C18H16ClNO5 and a molecular weight of 361.8 g/mol. IUPAC name: ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate. InChIKey: PQKBPHSEKWERTG-LLVKDONJSA-N.
| Molecular formula | C18H16ClNO5 |
|---|---|
| Molecular weight | 361.8 g/mol |
| IUPAC name | ethyl (2R)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate |
| InChIKey | PQKBPHSEKWERTG-LLVKDONJSA-N |
| SMILES | CCOC(=O)[C@@H](C)OC1=CC=C(C=C1)OC2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)