CAS 71324-20-4 appears in our catalog under these names: 4–HYDROXY–3–METHOXY–D3–PHENYLETHYLENE GLYCOL 4–SULPHATE POTASSIUM SALT, 4-Hydroxy-3-methoxyphenylglycol Sulfate Potassium Salt, Potassium 4-(1,2-dihydroxyethyl)-2-methoxyphenyl sulfate, 4-Hydroxy-3-methoxyphenylglycol sulfate (potassium), 98.82%. Offered by: GLPBio, TRC, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1g, 25mg, 100mg, 5 mg, 10 mg.
Potassium [4-(1,2-dihydroxyethyl)-2-methoxyphenyl] sulfate (CAS 71324-20-4) is a chemical compound with the molecular formula C9H11KO7S and a molecular weight of 302.34 g/mol. IUPAC name: potassium [4-(1,2-dihydroxyethyl)-2-methoxyphenyl] sulfate. InChIKey: XFZJWBFZLNLKNR-UHFFFAOYSA-M.
| Molecular formula | C9H11KO7S |
|---|---|
| Molecular weight | 302.34 g/mol |
| IUPAC name | potassium [4-(1,2-dihydroxyethyl)-2-methoxyphenyl] sulfate |
| InChIKey | XFZJWBFZLNLKNR-UHFFFAOYSA-M |
| SMILES | COC1=C(C=CC(=C1)C(CO)O)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)